C16H23F3IN3O2 — CID 111550603
(3R)-N-ethyl-3-hydroxy-N'-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]pyrrolidine-1-carboximidamide;hydroiodide (PubChem CID 111550603) has the molecular formula C16H23F3IN3O2 and a molecular weight of 473.28 g/mol. Its IUPAC name is (3R)-N-ethyl-3-hydroxy-N'-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]pyrrolidine-1-carboximidamide;hydroiodide.
| Compound Name | (3R)-N-ethyl-3-hydroxy-N'-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]pyrrolidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111550603 |
| Molecular Formula | C16H23F3IN3O2 |
| Molecular Weight | 473.28 g/mol |
| Exact Mass | 473.08 |
| IUPAC Name | (3R)-N-ethyl-3-hydroxy-N'-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]pyrrolidine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(OCC(F)(F)F)cc1)N1CC[C@@H](O)C1.I |
| InChI | InChI=1S/C16H22F3N3O2.HI/c1-2-20-15(22-8-7-13(23)10-22)21-9-12-3-5-14(6-4-12)24-11-16(17,18)19;/h3-6,13,23H,2,7-11H2,1H3,(H,20,21);1H/t13-;/m1./s1 |
| InChIKey | CZADMENMJBNIPB-BTQNPOSSSA-N |
| XLogP | 2.78 |
| TPSA | 57.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.28 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|