C17H24F3N3O2 — CID 111550930
(3R)-N-ethyl-3-hydroxy-N'-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]pyrrolidine-1-carboximidamide (PubChem CID 111550930) has the molecular formula C17H24F3N3O2 and a molecular weight of 359.39 g/mol. Its IUPAC name is (3R)-N-ethyl-3-hydroxy-N'-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]pyrrolidine-1-carboximidamide.
| Compound Name | (3R)-N-ethyl-3-hydroxy-N'-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111550930 |
| Molecular Formula | C17H24F3N3O2 |
| Molecular Weight | 359.39 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | (3R)-N-ethyl-3-hydroxy-N'-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]pyrrolidine-1-carboximidamide |
| SMILES | CCN/C(=N\Cc1ccc(COCC(F)(F)F)cc1)N1CC[C@@H](O)C1 |
| InChI | InChI=1S/C17H24F3N3O2/c1-2-21-16(23-8-7-15(24)10-23)22-9-13-3-5-14(6-4-13)11-25-12-17(18,19)20/h3-6,15,24H,2,7-12H2,1H3,(H,21,22)/t15-/m1/s1 |
| InChIKey | FRQDDPQPKVMYMG-OAHLLOKOSA-N |
| XLogP | 2.30 |
| TPSA | 57.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.39 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|