C21H31F3IN3O3 — CID 111157345
ethyl 1-[N-ethyl-N'-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]carbamimidoyl]piperidine-4-carboxylate;hydroiodide (PubChem CID 111157345) has the molecular formula C21H31F3IN3O3 and a molecular weight of 557.40 g/mol. Its IUPAC name is ethyl 1-[N-ethyl-N'-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]carbamimidoyl]piperidine-4-carboxylate;hydroiodide.
| Compound Name | ethyl 1-[N-ethyl-N'-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]carbamimidoyl]piperidine-4-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111157345 |
| Molecular Formula | C21H31F3IN3O3 |
| Molecular Weight | 557.40 g/mol |
| Exact Mass | 557.14 |
| IUPAC Name | ethyl 1-[N-ethyl-N'-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]carbamimidoyl]piperidine-4-carboxylate;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(COCC(F)(F)F)cc1)N1CCC(C(=O)OCC)CC1.I |
| InChI | InChI=1S/C21H30F3N3O3.HI/c1-3-25-20(27-11-9-18(10-12-27)19(28)30-4-2)26-13-16-5-7-17(8-6-16)14-29-15-21(22,23)24;/h5-8,18H,3-4,9-15H2,1-2H3,(H,25,26);1H |
| InChIKey | BYUSVQYYPSSIMA-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.40 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|