C20H29F3IN3O3 — CID 111156104
ethyl 1-[N'-methyl-N-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]carbamimidoyl]piperidine-4-carboxylate;hydroiodide (PubChem CID 111156104) has the molecular formula C20H29F3IN3O3 and a molecular weight of 543.37 g/mol. Its IUPAC name is ethyl 1-[N'-methyl-N-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]carbamimidoyl]piperidine-4-carboxylate;hydroiodide.
| Compound Name | ethyl 1-[N'-methyl-N-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]carbamimidoyl]piperidine-4-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111156104 |
| Molecular Formula | C20H29F3IN3O3 |
| Molecular Weight | 543.37 g/mol |
| Exact Mass | 543.12 |
| IUPAC Name | ethyl 1-[N'-methyl-N-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]carbamimidoyl]piperidine-4-carboxylate;hydroiodide |
| SMILES | CCOC(=O)C1CCN(/C(=N/C)NCc2ccc(COCC(F)(F)F)cc2)CC1.I |
| InChI | InChI=1S/C20H28F3N3O3.HI/c1-3-29-18(27)17-8-10-26(11-9-17)19(24-2)25-12-15-4-6-16(7-5-15)13-28-14-20(21,22)23;/h4-7,17H,3,8-14H2,1-2H3,(H,24,25);1H |
| InChIKey | XMIIMXRHDUHHHR-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.37 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|