C17H27IN4O3 — CID 111157339
ethyl 1-[N-[(6-methoxy-3-pyridinyl)methyl]-N'-methylcarbamimidoyl]piperidine-4-carboxylate;hydroiodide (PubChem CID 111157339) has the molecular formula C17H27IN4O3 and a molecular weight of 462.33 g/mol. Its IUPAC name is ethyl 1-[N-[(6-methoxy-3-pyridinyl)methyl]-N'-methylcarbamimidoyl]piperidine-4-carboxylate;hydroiodide.
| Compound Name | ethyl 1-[N-[(6-methoxy-3-pyridinyl)methyl]-N'-methylcarbamimidoyl]piperidine-4-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111157339 |
| Molecular Formula | C17H27IN4O3 |
| Molecular Weight | 462.33 g/mol |
| Exact Mass | 462.11 |
| IUPAC Name | ethyl 1-[N-[(6-methoxy-3-pyridinyl)methyl]-N'-methylcarbamimidoyl]piperidine-4-carboxylate;hydroiodide |
| SMILES | CCOC(=O)C1CCN(/C(=N/C)NCc2ccc(OC)nc2)CC1.I |
| InChI | InChI=1S/C17H26N4O3.HI/c1-4-24-16(22)14-7-9-21(10-8-14)17(18-2)20-12-13-5-6-15(23-3)19-11-13;/h5-6,11,14H,4,7-10,12H2,1-3H3,(H,18,20);1H |
| InChIKey | GJDKGIKIDQQJID-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 76.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.33 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|