C21H33N5O3 — CID 111155316
ethyl 1-[N'-methyl-N-[[6-(2-methylmorpholin-4-yl)-3-pyridinyl]methyl]carbamimidoyl]piperidine-4-carboxylate (PubChem CID 111155316) has the molecular formula C21H33N5O3 and a molecular weight of 403.53 g/mol. Its IUPAC name is ethyl 1-[N'-methyl-N-[[6-(2-methylmorpholin-4-yl)-3-pyridinyl]methyl]carbamimidoyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[N'-methyl-N-[[6-(2-methylmorpholin-4-yl)-3-pyridinyl]methyl]carbamimidoyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 111155316 |
| Molecular Formula | C21H33N5O3 |
| Molecular Weight | 403.53 g/mol |
| Exact Mass | 403.26 |
| IUPAC Name | ethyl 1-[N'-methyl-N-[[6-(2-methylmorpholin-4-yl)-3-pyridinyl]methyl]carbamimidoyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(/C(=N/C)NCc2ccc(N3CCOC(C)C3)nc2)CC1 |
| InChI | InChI=1S/C21H33N5O3/c1-4-28-20(27)18-7-9-25(10-8-18)21(22-3)24-14-17-5-6-19(23-13-17)26-11-12-29-16(2)15-26/h5-6,13,16,18H,4,7-12,14-15H2,1-3H3,(H,22,24) |
| InChIKey | YZMKCLAHCCMWCQ-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.53 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|