C24H33N5O2 — CID 109427187
N'-methyl-N-[[6-(2-methylmorpholin-4-yl)-3-pyridinyl]methyl]-4-phenoxypiperidine-1-carboximidamide (PubChem CID 109427187) has the molecular formula C24H33N5O2 and a molecular weight of 423.56 g/mol. Its IUPAC name is N'-methyl-N-[[6-(2-methylmorpholin-4-yl)-3-pyridinyl]methyl]-4-phenoxypiperidine-1-carboximidamide.
| Compound Name | N'-methyl-N-[[6-(2-methylmorpholin-4-yl)-3-pyridinyl]methyl]-4-phenoxypiperidine-1-carboximidamide |
|---|---|
| PubChem CID | 109427187 |
| Molecular Formula | C24H33N5O2 |
| Molecular Weight | 423.56 g/mol |
| Exact Mass | 423.26 |
| IUPAC Name | N'-methyl-N-[[6-(2-methylmorpholin-4-yl)-3-pyridinyl]methyl]-4-phenoxypiperidine-1-carboximidamide |
| SMILES | C/N=C(\NCc1ccc(N2CCOC(C)C2)nc1)N1CCC(Oc2ccccc2)CC1 |
| InChI | InChI=1S/C24H33N5O2/c1-19-18-29(14-15-30-19)23-9-8-20(16-26-23)17-27-24(25-2)28-12-10-22(11-13-28)31-21-6-4-3-5-7-21/h3-9,16,19,22H,10-15,17-18H2,1-2H3,(H,25,27) |
| InChIKey | JDMDHMDAYQCUJC-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.56 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|