C17H23F3N4O3 — CID 111254225
methyl 1-[N'-methyl-N-[[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]carbamimidoyl]piperidine-4-carboxylate (PubChem CID 111254225) has the molecular formula C17H23F3N4O3 and a molecular weight of 388.39 g/mol. Its IUPAC name is methyl 1-[N'-methyl-N-[[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]carbamimidoyl]piperidine-4-carboxylate.
| Compound Name | methyl 1-[N'-methyl-N-[[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]carbamimidoyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 111254225 |
| Molecular Formula | C17H23F3N4O3 |
| Molecular Weight | 388.39 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | methyl 1-[N'-methyl-N-[[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]carbamimidoyl]piperidine-4-carboxylate |
| SMILES | C/N=C(\NCc1ccc(OCC(F)(F)F)nc1)N1CCC(C(=O)OC)CC1 |
| InChI | InChI=1S/C17H23F3N4O3/c1-21-16(24-7-5-13(6-8-24)15(25)26-2)23-10-12-3-4-14(22-9-12)27-11-17(18,19)20/h3-4,9,13H,5-8,10-11H2,1-2H3,(H,21,23) |
| InChIKey | XIBDUFPMGIYLDE-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 76.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.39 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|