C20H24F3N5O — CID 110960663
N'-methyl-4-phenyl-N-[[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]piperazine-1-carboximidamide (PubChem CID 110960663) has the molecular formula C20H24F3N5O and a molecular weight of 407.44 g/mol. Its IUPAC name is N'-methyl-4-phenyl-N-[[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]piperazine-1-carboximidamide.
| Compound Name | N'-methyl-4-phenyl-N-[[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 110960663 |
| Molecular Formula | C20H24F3N5O |
| Molecular Weight | 407.44 g/mol |
| Exact Mass | 407.19 |
| IUPAC Name | N'-methyl-4-phenyl-N-[[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]piperazine-1-carboximidamide |
| SMILES | C/N=C(\NCc1ccc(OCC(F)(F)F)nc1)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C20H24F3N5O/c1-24-19(28-11-9-27(10-12-28)17-5-3-2-4-6-17)26-14-16-7-8-18(25-13-16)29-15-20(21,22)23/h2-8,13H,9-12,14-15H2,1H3,(H,24,26) |
| InChIKey | ZGMHQJJIUNDRHF-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 52.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.44 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|