C21H25F3N4O2 — CID 109481092
N'-methyl-2-(2-methylphenyl)-N-[[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]morpholine-4-carboximidamide (PubChem CID 109481092) has the molecular formula C21H25F3N4O2 and a molecular weight of 422.45 g/mol. Its IUPAC name is N'-methyl-2-(2-methylphenyl)-N-[[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]morpholine-4-carboximidamide.
| Compound Name | N'-methyl-2-(2-methylphenyl)-N-[[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]morpholine-4-carboximidamide |
|---|---|
| PubChem CID | 109481092 |
| Molecular Formula | C21H25F3N4O2 |
| Molecular Weight | 422.45 g/mol |
| Exact Mass | 422.19 |
| IUPAC Name | N'-methyl-2-(2-methylphenyl)-N-[[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]morpholine-4-carboximidamide |
| SMILES | C/N=C(\NCc1ccc(OCC(F)(F)F)nc1)N1CCOC(c2ccccc2C)C1 |
| InChI | InChI=1S/C21H25F3N4O2/c1-15-5-3-4-6-17(15)18-13-28(9-10-29-18)20(25-2)27-12-16-7-8-19(26-11-16)30-14-21(22,23)24/h3-8,11,18H,9-10,12-14H2,1-2H3,(H,25,27) |
| InChIKey | JYENVBDIIUEXLB-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 58.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.45 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|