C24H29N5O — CID 109479945
N-[(1-benzylpyrazol-4-yl)methyl]-N'-methyl-2-(2-methylphenyl)morpholine-4-carboximidamide (PubChem CID 109479945) has the molecular formula C24H29N5O and a molecular weight of 403.53 g/mol. Its IUPAC name is N-[(1-benzylpyrazol-4-yl)methyl]-N'-methyl-2-(2-methylphenyl)morpholine-4-carboximidamide.
| Compound Name | N-[(1-benzylpyrazol-4-yl)methyl]-N'-methyl-2-(2-methylphenyl)morpholine-4-carboximidamide |
|---|---|
| PubChem CID | 109479945 |
| Molecular Formula | C24H29N5O |
| Molecular Weight | 403.53 g/mol |
| Exact Mass | 403.24 |
| IUPAC Name | N-[(1-benzylpyrazol-4-yl)methyl]-N'-methyl-2-(2-methylphenyl)morpholine-4-carboximidamide |
| SMILES | C/N=C(\NCc1cnn(Cc2ccccc2)c1)N1CCOC(c2ccccc2C)C1 |
| InChI | InChI=1S/C24H29N5O/c1-19-8-6-7-11-22(19)23-18-28(12-13-30-23)24(25-2)26-14-21-15-27-29(17-21)16-20-9-4-3-5-10-20/h3-11,15,17,23H,12-14,16,18H2,1-2H3,(H,25,26) |
| InChIKey | PHYAFSIVGPKQHS-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 54.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.53 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|