C22H29N3O3 — CID 109480916
N-[(3,4-dimethoxyphenyl)methyl]-N'-methyl-2-(2-methylphenyl)morpholine-4-carboximidamide (PubChem CID 109480916) has the molecular formula C22H29N3O3 and a molecular weight of 383.49 g/mol. Its IUPAC name is N-[(3,4-dimethoxyphenyl)methyl]-N'-methyl-2-(2-methylphenyl)morpholine-4-carboximidamide.
| Compound Name | N-[(3,4-dimethoxyphenyl)methyl]-N'-methyl-2-(2-methylphenyl)morpholine-4-carboximidamide |
|---|---|
| PubChem CID | 109480916 |
| Molecular Formula | C22H29N3O3 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.22 |
| IUPAC Name | N-[(3,4-dimethoxyphenyl)methyl]-N'-methyl-2-(2-methylphenyl)morpholine-4-carboximidamide |
| SMILES | C/N=C(\NCc1ccc(OC)c(OC)c1)N1CCOC(c2ccccc2C)C1 |
| InChI | InChI=1S/C22H29N3O3/c1-16-7-5-6-8-18(16)21-15-25(11-12-28-21)22(23-2)24-14-17-9-10-19(26-3)20(13-17)27-4/h5-10,13,21H,11-12,14-15H2,1-4H3,(H,23,24) |
| InChIKey | NIOWZLLRRVVYNE-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 55.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|