C23H31FN4O — CID 109481859
N-[[3-[(dimethylamino)methyl]-4-fluorophenyl]methyl]-N'-methyl-2-(2-methylphenyl)morpholine-4-carboximidamide (PubChem CID 109481859) has the molecular formula C23H31FN4O and a molecular weight of 398.53 g/mol. Its IUPAC name is N-[[3-[(dimethylamino)methyl]-4-fluorophenyl]methyl]-N'-methyl-2-(2-methylphenyl)morpholine-4-carboximidamide.
| Compound Name | N-[[3-[(dimethylamino)methyl]-4-fluorophenyl]methyl]-N'-methyl-2-(2-methylphenyl)morpholine-4-carboximidamide |
|---|---|
| PubChem CID | 109481859 |
| Molecular Formula | C23H31FN4O |
| Molecular Weight | 398.53 g/mol |
| Exact Mass | 398.25 |
| IUPAC Name | N-[[3-[(dimethylamino)methyl]-4-fluorophenyl]methyl]-N'-methyl-2-(2-methylphenyl)morpholine-4-carboximidamide |
| SMILES | C/N=C(\NCc1ccc(F)c(CN(C)C)c1)N1CCOC(c2ccccc2C)C1 |
| InChI | InChI=1S/C23H31FN4O/c1-17-7-5-6-8-20(17)22-16-28(11-12-29-22)23(25-2)26-14-18-9-10-21(24)19(13-18)15-27(3)4/h5-10,13,22H,11-12,14-16H2,1-4H3,(H,25,26) |
| InChIKey | RRPAIWQYOQKOLF-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 40.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.53 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|