C21H26F3N5O2 — CID 111242245
4-(4-methoxyphenyl)-N'-methyl-N-[[2-(2,2,2-trifluoroethoxy)-4-pyridinyl]methyl]piperazine-1-carboximidamide (PubChem CID 111242245) has the molecular formula C21H26F3N5O2 and a molecular weight of 437.47 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)-N'-methyl-N-[[2-(2,2,2-trifluoroethoxy)-4-pyridinyl]methyl]piperazine-1-carboximidamide.
| Compound Name | 4-(4-methoxyphenyl)-N'-methyl-N-[[2-(2,2,2-trifluoroethoxy)-4-pyridinyl]methyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111242245 |
| Molecular Formula | C21H26F3N5O2 |
| Molecular Weight | 437.47 g/mol |
| Exact Mass | 437.20 |
| IUPAC Name | 4-(4-methoxyphenyl)-N'-methyl-N-[[2-(2,2,2-trifluoroethoxy)-4-pyridinyl]methyl]piperazine-1-carboximidamide |
| SMILES | C/N=C(\NCc1ccnc(OCC(F)(F)F)c1)N1CCN(c2ccc(OC)cc2)CC1 |
| InChI | InChI=1S/C21H26F3N5O2/c1-25-20(27-14-16-7-8-26-19(13-16)31-15-21(22,23)24)29-11-9-28(10-12-29)17-3-5-18(30-2)6-4-17/h3-8,13H,9-12,14-15H2,1-2H3,(H,25,27) |
| InChIKey | JREWYQVNSRTBMY-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.47 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|