C24H41IN4O3 — CID 111154913
ethyl 1-[N'-[[4-[2-(diethylamino)ethoxy]phenyl]methyl]-N-ethylcarbamimidoyl]piperidine-4-carboxylate;hydroiodide (PubChem CID 111154913) has the molecular formula C24H41IN4O3 and a molecular weight of 560.52 g/mol. Its IUPAC name is ethyl 1-[N'-[[4-[2-(diethylamino)ethoxy]phenyl]methyl]-N-ethylcarbamimidoyl]piperidine-4-carboxylate;hydroiodide.
| Compound Name | ethyl 1-[N'-[[4-[2-(diethylamino)ethoxy]phenyl]methyl]-N-ethylcarbamimidoyl]piperidine-4-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111154913 |
| Molecular Formula | C24H41IN4O3 |
| Molecular Weight | 560.52 g/mol |
| Exact Mass | 560.22 |
| IUPAC Name | ethyl 1-[N'-[[4-[2-(diethylamino)ethoxy]phenyl]methyl]-N-ethylcarbamimidoyl]piperidine-4-carboxylate;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(OCCN(CC)CC)cc1)N1CCC(C(=O)OCC)CC1.I |
| InChI | InChI=1S/C24H40N4O3.HI/c1-5-25-24(28-15-13-21(14-16-28)23(29)30-8-4)26-19-20-9-11-22(12-10-20)31-18-17-27(6-2)7-3;/h9-12,21H,5-8,13-19H2,1-4H3,(H,25,26);1H |
| InChIKey | XYQMBJFBCAEPHE-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.52 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|