C24H41N5O2 — CID 111727723
N'-[[4-[2-(diethylamino)ethoxy]phenyl]methyl]-N-ethyl-3-morpholin-4-ylpyrrolidine-1-carboximidamide (PubChem CID 111727723) has the molecular formula C24H41N5O2 and a molecular weight of 431.63 g/mol. Its IUPAC name is N'-[[4-[2-(diethylamino)ethoxy]phenyl]methyl]-N-ethyl-3-morpholin-4-ylpyrrolidine-1-carboximidamide.
| Compound Name | N'-[[4-[2-(diethylamino)ethoxy]phenyl]methyl]-N-ethyl-3-morpholin-4-ylpyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111727723 |
| Molecular Formula | C24H41N5O2 |
| Molecular Weight | 431.63 g/mol |
| Exact Mass | 431.33 |
| IUPAC Name | N'-[[4-[2-(diethylamino)ethoxy]phenyl]methyl]-N-ethyl-3-morpholin-4-ylpyrrolidine-1-carboximidamide |
| SMILES | CCN/C(=N\Cc1ccc(OCCN(CC)CC)cc1)N1CCC(N2CCOCC2)C1 |
| InChI | InChI=1S/C24H41N5O2/c1-4-25-24(29-12-11-22(20-29)28-14-16-30-17-15-28)26-19-21-7-9-23(10-8-21)31-18-13-27(5-2)6-3/h7-10,22H,4-6,11-20H2,1-3H3,(H,25,26) |
| InChIKey | MBRGZEFORKAUTD-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.63 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|