C15H23FIN3O2 — CID 111549999
(3R)-N-ethyl-N'-[(3-fluoro-4-methoxyphenyl)methyl]-3-hydroxypyrrolidine-1-carboximidamide;hydroiodide (PubChem CID 111549999) has the molecular formula C15H23FIN3O2 and a molecular weight of 423.27 g/mol. Its IUPAC name is (3R)-N-ethyl-N'-[(3-fluoro-4-methoxyphenyl)methyl]-3-hydroxypyrrolidine-1-carboximidamide;hydroiodide.
| Compound Name | (3R)-N-ethyl-N'-[(3-fluoro-4-methoxyphenyl)methyl]-3-hydroxypyrrolidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111549999 |
| Molecular Formula | C15H23FIN3O2 |
| Molecular Weight | 423.27 g/mol |
| Exact Mass | 423.08 |
| IUPAC Name | (3R)-N-ethyl-N'-[(3-fluoro-4-methoxyphenyl)methyl]-3-hydroxypyrrolidine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(OC)c(F)c1)N1CC[C@@H](O)C1.I |
| InChI | InChI=1S/C15H22FN3O2.HI/c1-3-17-15(19-7-6-12(20)10-19)18-9-11-4-5-14(21-2)13(16)8-11;/h4-5,8,12,20H,3,6-7,9-10H2,1-2H3,(H,17,18);1H/t12-;/m1./s1 |
| InChIKey | JNMOYLDNMIDASC-UTONKHPSSA-N |
| XLogP | 1.98 |
| TPSA | 57.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.27 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|