C18H29FIN3O2 — CID 111959876
4-ethoxy-N-ethyl-N'-[(3-fluoro-4-methoxyphenyl)methyl]piperidine-1-carboximidamide;hydroiodide (PubChem CID 111959876) has the molecular formula C18H29FIN3O2 and a molecular weight of 465.35 g/mol. Its IUPAC name is 4-ethoxy-N-ethyl-N'-[(3-fluoro-4-methoxyphenyl)methyl]piperidine-1-carboximidamide;hydroiodide.
| Compound Name | 4-ethoxy-N-ethyl-N'-[(3-fluoro-4-methoxyphenyl)methyl]piperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111959876 |
| Molecular Formula | C18H29FIN3O2 |
| Molecular Weight | 465.35 g/mol |
| Exact Mass | 465.13 |
| IUPAC Name | 4-ethoxy-N-ethyl-N'-[(3-fluoro-4-methoxyphenyl)methyl]piperidine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(OC)c(F)c1)N1CCC(OCC)CC1.I |
| InChI | InChI=1S/C18H28FN3O2.HI/c1-4-20-18(22-10-8-15(9-11-22)24-5-2)21-13-14-6-7-17(23-3)16(19)12-14;/h6-7,12,15H,4-5,8-11,13H2,1-3H3,(H,20,21);1H |
| InChIKey | ZFTJKZUEHMNPFM-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 46.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.35 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|