C20H32F2IN3O3 — CID 111959144
N'-[[4-(difluoromethoxy)-3-ethoxyphenyl]methyl]-4-ethoxy-N-ethylpiperidine-1-carboximidamide;hydroiodide (PubChem CID 111959144) has the molecular formula C20H32F2IN3O3 and a molecular weight of 527.39 g/mol. Its IUPAC name is N'-[[4-(difluoromethoxy)-3-ethoxyphenyl]methyl]-4-ethoxy-N-ethylpiperidine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[[4-(difluoromethoxy)-3-ethoxyphenyl]methyl]-4-ethoxy-N-ethylpiperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111959144 |
| Molecular Formula | C20H32F2IN3O3 |
| Molecular Weight | 527.39 g/mol |
| Exact Mass | 527.15 |
| IUPAC Name | N'-[[4-(difluoromethoxy)-3-ethoxyphenyl]methyl]-4-ethoxy-N-ethylpiperidine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(OC(F)F)c(OCC)c1)N1CCC(OCC)CC1.I |
| InChI | InChI=1S/C20H31F2N3O3.HI/c1-4-23-20(25-11-9-16(10-12-25)26-5-2)24-14-15-7-8-17(28-19(21)22)18(13-15)27-6-3;/h7-8,13,16,19H,4-6,9-12,14H2,1-3H3,(H,23,24);1H |
| InChIKey | KLDNKPXDSVZROI-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 55.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.39 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|