C21H30F2IN5O2 — CID 111742514
N'-[[4-(difluoromethoxy)-3-ethoxyphenyl]methyl]-N-ethyl-3-(1-methylpyrazol-4-yl)pyrrolidine-1-carboximidamide;hydroiodide (PubChem CID 111742514) has the molecular formula C21H30F2IN5O2 and a molecular weight of 549.40 g/mol. Its IUPAC name is N'-[[4-(difluoromethoxy)-3-ethoxyphenyl]methyl]-N-ethyl-3-(1-methylpyrazol-4-yl)pyrrolidine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[[4-(difluoromethoxy)-3-ethoxyphenyl]methyl]-N-ethyl-3-(1-methylpyrazol-4-yl)pyrrolidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111742514 |
| Molecular Formula | C21H30F2IN5O2 |
| Molecular Weight | 549.40 g/mol |
| Exact Mass | 549.14 |
| IUPAC Name | N'-[[4-(difluoromethoxy)-3-ethoxyphenyl]methyl]-N-ethyl-3-(1-methylpyrazol-4-yl)pyrrolidine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(OC(F)F)c(OCC)c1)N1CCC(c2cnn(C)c2)C1.I |
| InChI | InChI=1S/C21H29F2N5O2.HI/c1-4-24-21(28-9-8-16(14-28)17-12-26-27(3)13-17)25-11-15-6-7-18(30-20(22)23)19(10-15)29-5-2;/h6-7,10,12-13,16,20H,4-5,8-9,11,14H2,1-3H3,(H,24,25);1H |
| InChIKey | UZNGQQBYTFHHPO-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 63.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.40 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|