C17H23ClN6 — CID 111743141
N'-[(6-chloro-3-pyridinyl)methyl]-N-ethyl-3-(1-methylpyrazol-4-yl)pyrrolidine-1-carboximidamide (PubChem CID 111743141) has the molecular formula C17H23ClN6 and a molecular weight of 346.87 g/mol. Its IUPAC name is N'-[(6-chloro-3-pyridinyl)methyl]-N-ethyl-3-(1-methylpyrazol-4-yl)pyrrolidine-1-carboximidamide.
| Compound Name | N'-[(6-chloro-3-pyridinyl)methyl]-N-ethyl-3-(1-methylpyrazol-4-yl)pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111743141 |
| Molecular Formula | C17H23ClN6 |
| Molecular Weight | 346.87 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | N'-[(6-chloro-3-pyridinyl)methyl]-N-ethyl-3-(1-methylpyrazol-4-yl)pyrrolidine-1-carboximidamide |
| SMILES | CCN/C(=N\Cc1ccc(Cl)nc1)N1CCC(c2cnn(C)c2)C1 |
| InChI | InChI=1S/C17H23ClN6/c1-3-19-17(21-9-13-4-5-16(18)20-8-13)24-7-6-14(12-24)15-10-22-23(2)11-15/h4-5,8,10-11,14H,3,6-7,9,12H2,1-2H3,(H,19,21) |
| InChIKey | LFMSUGDZKRABPG-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 58.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.87 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|