C23H34N6O — CID 111742809
N-ethyl-3-(1-methylpyrazol-4-yl)-N'-[[4-(morpholin-4-ylmethyl)phenyl]methyl]pyrrolidine-1-carboximidamide (PubChem CID 111742809) has the molecular formula C23H34N6O and a molecular weight of 410.57 g/mol. Its IUPAC name is N-ethyl-3-(1-methylpyrazol-4-yl)-N'-[[4-(morpholin-4-ylmethyl)phenyl]methyl]pyrrolidine-1-carboximidamide.
| Compound Name | N-ethyl-3-(1-methylpyrazol-4-yl)-N'-[[4-(morpholin-4-ylmethyl)phenyl]methyl]pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111742809 |
| Molecular Formula | C23H34N6O |
| Molecular Weight | 410.57 g/mol |
| Exact Mass | 410.28 |
| IUPAC Name | N-ethyl-3-(1-methylpyrazol-4-yl)-N'-[[4-(morpholin-4-ylmethyl)phenyl]methyl]pyrrolidine-1-carboximidamide |
| SMILES | CCN/C(=N\Cc1ccc(CN2CCOCC2)cc1)N1CCC(c2cnn(C)c2)C1 |
| InChI | InChI=1S/C23H34N6O/c1-3-24-23(29-9-8-21(18-29)22-15-26-27(2)17-22)25-14-19-4-6-20(7-5-19)16-28-10-12-30-13-11-28/h4-7,15,17,21H,3,8-14,16,18H2,1-2H3,(H,24,25) |
| InChIKey | IGDPOINDFDHZKT-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 57.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.57 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|