C25H32IN5O — CID 111741319
N-ethyl-3-(1-methylpyrazol-4-yl)-N'-[(4-phenylmethoxyphenyl)methyl]pyrrolidine-1-carboximidamide;hydroiodide (PubChem CID 111741319) has the molecular formula C25H32IN5O and a molecular weight of 545.47 g/mol. Its IUPAC name is N-ethyl-3-(1-methylpyrazol-4-yl)-N'-[(4-phenylmethoxyphenyl)methyl]pyrrolidine-1-carboximidamide;hydroiodide.
| Compound Name | N-ethyl-3-(1-methylpyrazol-4-yl)-N'-[(4-phenylmethoxyphenyl)methyl]pyrrolidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111741319 |
| Molecular Formula | C25H32IN5O |
| Molecular Weight | 545.47 g/mol |
| Exact Mass | 545.17 |
| IUPAC Name | N-ethyl-3-(1-methylpyrazol-4-yl)-N'-[(4-phenylmethoxyphenyl)methyl]pyrrolidine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(OCc2ccccc2)cc1)N1CCC(c2cnn(C)c2)C1.I |
| InChI | InChI=1S/C25H31N5O.HI/c1-3-26-25(30-14-13-22(18-30)23-16-28-29(2)17-23)27-15-20-9-11-24(12-10-20)31-19-21-7-5-4-6-8-21;/h4-12,16-17,22H,3,13-15,18-19H2,1-2H3,(H,26,27);1H |
| InChIKey | HFCKPGBPALTKIA-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 54.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.47 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|