C21H33IN6 — CID 111742806
N'-[[4-[(dimethylamino)methyl]phenyl]methyl]-N-ethyl-3-(1-methylpyrazol-4-yl)pyrrolidine-1-carboximidamide;hydroiodide (PubChem CID 111742806) has the molecular formula C21H33IN6 and a molecular weight of 496.44 g/mol. Its IUPAC name is N'-[[4-[(dimethylamino)methyl]phenyl]methyl]-N-ethyl-3-(1-methylpyrazol-4-yl)pyrrolidine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[[4-[(dimethylamino)methyl]phenyl]methyl]-N-ethyl-3-(1-methylpyrazol-4-yl)pyrrolidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111742806 |
| Molecular Formula | C21H33IN6 |
| Molecular Weight | 496.44 g/mol |
| Exact Mass | 496.18 |
| IUPAC Name | N'-[[4-[(dimethylamino)methyl]phenyl]methyl]-N-ethyl-3-(1-methylpyrazol-4-yl)pyrrolidine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(CN(C)C)cc1)N1CCC(c2cnn(C)c2)C1.I |
| InChI | InChI=1S/C21H32N6.HI/c1-5-22-21(23-12-17-6-8-18(9-7-17)14-25(2)3)27-11-10-19(16-27)20-13-24-26(4)15-20;/h6-9,13,15,19H,5,10-12,14,16H2,1-4H3,(H,22,23);1H |
| InChIKey | JHBLABBFADZOLU-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 48.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.44 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|