C18H26N6O2S — CID 111742161
N-ethyl-3-(1-methylpyrazol-4-yl)-N'-[(4-sulfamoylphenyl)methyl]pyrrolidine-1-carboximidamide (PubChem CID 111742161) has the molecular formula C18H26N6O2S and a molecular weight of 390.51 g/mol. Its IUPAC name is N-ethyl-3-(1-methylpyrazol-4-yl)-N'-[(4-sulfamoylphenyl)methyl]pyrrolidine-1-carboximidamide.
| Compound Name | N-ethyl-3-(1-methylpyrazol-4-yl)-N'-[(4-sulfamoylphenyl)methyl]pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111742161 |
| Molecular Formula | C18H26N6O2S |
| Molecular Weight | 390.51 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | N-ethyl-3-(1-methylpyrazol-4-yl)-N'-[(4-sulfamoylphenyl)methyl]pyrrolidine-1-carboximidamide |
| SMILES | CCN/C(=N\Cc1ccc(S(N)(=O)=O)cc1)N1CCC(c2cnn(C)c2)C1 |
| InChI | InChI=1S/C18H26N6O2S/c1-3-20-18(21-10-14-4-6-17(7-5-14)27(19,25)26)24-9-8-15(13-24)16-11-22-23(2)12-16/h4-7,11-12,15H,3,8-10,13H2,1-2H3,(H,20,21)(H2,19,25,26) |
| InChIKey | CZWDVOKTDPHXDZ-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 105.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.51 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|