C13H24N6O2S — CID 111743125
N-ethyl-3-(1-methylpyrazol-4-yl)-N'-(2-sulfamoylethyl)pyrrolidine-1-carboximidamide (PubChem CID 111743125) has the molecular formula C13H24N6O2S and a molecular weight of 328.44 g/mol. Its IUPAC name is N-ethyl-3-(1-methylpyrazol-4-yl)-N'-(2-sulfamoylethyl)pyrrolidine-1-carboximidamide.
| Compound Name | N-ethyl-3-(1-methylpyrazol-4-yl)-N'-(2-sulfamoylethyl)pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111743125 |
| Molecular Formula | C13H24N6O2S |
| Molecular Weight | 328.44 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | N-ethyl-3-(1-methylpyrazol-4-yl)-N'-(2-sulfamoylethyl)pyrrolidine-1-carboximidamide |
| SMILES | CCN/C(=N\CCS(N)(=O)=O)N1CCC(c2cnn(C)c2)C1 |
| InChI | InChI=1S/C13H24N6O2S/c1-3-15-13(16-5-7-22(14,20)21)19-6-4-11(10-19)12-8-17-18(2)9-12/h8-9,11H,3-7,10H2,1-2H3,(H,15,16)(H2,14,20,21) |
| InChIKey | SICAXGMUFZQGTD-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 105.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.44 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|