C20H39IN6 — CID 111741153
N'-[3-(dipropylamino)propyl]-N-ethyl-3-(1-methylpyrazol-4-yl)pyrrolidine-1-carboximidamide;hydroiodide (PubChem CID 111741153) has the molecular formula C20H39IN6 and a molecular weight of 490.48 g/mol. Its IUPAC name is N'-[3-(dipropylamino)propyl]-N-ethyl-3-(1-methylpyrazol-4-yl)pyrrolidine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[3-(dipropylamino)propyl]-N-ethyl-3-(1-methylpyrazol-4-yl)pyrrolidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111741153 |
| Molecular Formula | C20H39IN6 |
| Molecular Weight | 490.48 g/mol |
| Exact Mass | 490.23 |
| IUPAC Name | N'-[3-(dipropylamino)propyl]-N-ethyl-3-(1-methylpyrazol-4-yl)pyrrolidine-1-carboximidamide;hydroiodide |
| SMILES | CCCN(CCC)CCC/N=C(\NCC)N1CCC(c2cnn(C)c2)C1.I |
| InChI | InChI=1S/C20H38N6.HI/c1-5-11-25(12-6-2)13-8-10-22-20(21-7-3)26-14-9-18(17-26)19-15-23-24(4)16-19;/h15-16,18H,5-14,17H2,1-4H3,(H,21,22);1H |
| InChIKey | FSXKXRGJXUOGHY-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 48.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.48 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|