C20H35N5 — CID 111741158
N-ethyl-N'-[(4-ethylcyclohexyl)methyl]-3-(1-methylpyrazol-4-yl)pyrrolidine-1-carboximidamide (PubChem CID 111741158) has the molecular formula C20H35N5 and a molecular weight of 345.54 g/mol. Its IUPAC name is N-ethyl-N'-[(4-ethylcyclohexyl)methyl]-3-(1-methylpyrazol-4-yl)pyrrolidine-1-carboximidamide.
| Compound Name | N-ethyl-N'-[(4-ethylcyclohexyl)methyl]-3-(1-methylpyrazol-4-yl)pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111741158 |
| Molecular Formula | C20H35N5 |
| Molecular Weight | 345.54 g/mol |
| Exact Mass | 345.29 |
| IUPAC Name | N-ethyl-N'-[(4-ethylcyclohexyl)methyl]-3-(1-methylpyrazol-4-yl)pyrrolidine-1-carboximidamide |
| SMILES | CCN/C(=N\CC1CCC(CC)CC1)N1CCC(c2cnn(C)c2)C1 |
| InChI | InChI=1S/C20H35N5/c1-4-16-6-8-17(9-7-16)12-22-20(21-5-2)25-11-10-18(15-25)19-13-23-24(3)14-19/h13-14,16-18H,4-12,15H2,1-3H3,(H,21,22) |
| InChIKey | VDTYIEGBQGHCAR-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 45.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.54 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|