C23H29IN6O2 — CID 111741187
N-[4-[[[ethylamino-[3-(1-methylpyrazol-4-yl)pyrrolidin-1-yl]methylidene]amino]methyl]phenyl]furan-2-carboxamide;hydroiodide (PubChem CID 111741187) has the molecular formula C23H29IN6O2 and a molecular weight of 548.43 g/mol. Its IUPAC name is N-[4-[[[ethylamino-[3-(1-methylpyrazol-4-yl)pyrrolidin-1-yl]methylidene]amino]methyl]phenyl]furan-2-carboxamide;hydroiodide.
| Compound Name | N-[4-[[[ethylamino-[3-(1-methylpyrazol-4-yl)pyrrolidin-1-yl]methylidene]amino]methyl]phenyl]furan-2-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111741187 |
| Molecular Formula | C23H29IN6O2 |
| Molecular Weight | 548.43 g/mol |
| Exact Mass | 548.14 |
| IUPAC Name | N-[4-[[[ethylamino-[3-(1-methylpyrazol-4-yl)pyrrolidin-1-yl]methylidene]amino]methyl]phenyl]furan-2-carboxamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(NC(=O)c2ccco2)cc1)N1CCC(c2cnn(C)c2)C1.I |
| InChI | InChI=1S/C23H28N6O2.HI/c1-3-24-23(29-11-10-18(16-29)19-14-26-28(2)15-19)25-13-17-6-8-20(9-7-17)27-22(30)21-5-4-12-31-21;/h4-9,12,14-15,18H,3,10-11,13,16H2,1-2H3,(H,24,25)(H,27,30);1H |
| InChIKey | ZXJLRDRAOYQMBD-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 87.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.43 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|