C24H36N6O2 — CID 111742121
N-ethyl-3-(1-methylpyrazol-4-yl)-N'-[[2-(2-morpholin-4-ylethoxy)phenyl]methyl]pyrrolidine-1-carboximidamide (PubChem CID 111742121) has the molecular formula C24H36N6O2 and a molecular weight of 440.59 g/mol. Its IUPAC name is N-ethyl-3-(1-methylpyrazol-4-yl)-N'-[[2-(2-morpholin-4-ylethoxy)phenyl]methyl]pyrrolidine-1-carboximidamide.
| Compound Name | N-ethyl-3-(1-methylpyrazol-4-yl)-N'-[[2-(2-morpholin-4-ylethoxy)phenyl]methyl]pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111742121 |
| Molecular Formula | C24H36N6O2 |
| Molecular Weight | 440.59 g/mol |
| Exact Mass | 440.29 |
| IUPAC Name | N-ethyl-3-(1-methylpyrazol-4-yl)-N'-[[2-(2-morpholin-4-ylethoxy)phenyl]methyl]pyrrolidine-1-carboximidamide |
| SMILES | CCN/C(=N\Cc1ccccc1OCCN1CCOCC1)N1CCC(c2cnn(C)c2)C1 |
| InChI | InChI=1S/C24H36N6O2/c1-3-25-24(30-9-8-21(19-30)22-17-27-28(2)18-22)26-16-20-6-4-5-7-23(20)32-15-12-29-10-13-31-14-11-29/h4-7,17-18,21H,3,8-16,19H2,1-2H3,(H,25,26) |
| InChIKey | PMALIHKMMMOQKQ-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.59 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|