C23H34N6O2 — CID 111742709
N'-methyl-3-(1-methylpyrazol-4-yl)-N-[[2-(2-morpholin-4-ylethoxy)phenyl]methyl]pyrrolidine-1-carboximidamide (PubChem CID 111742709) has the molecular formula C23H34N6O2 and a molecular weight of 426.57 g/mol. Its IUPAC name is N'-methyl-3-(1-methylpyrazol-4-yl)-N-[[2-(2-morpholin-4-ylethoxy)phenyl]methyl]pyrrolidine-1-carboximidamide.
| Compound Name | N'-methyl-3-(1-methylpyrazol-4-yl)-N-[[2-(2-morpholin-4-ylethoxy)phenyl]methyl]pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111742709 |
| Molecular Formula | C23H34N6O2 |
| Molecular Weight | 426.57 g/mol |
| Exact Mass | 426.27 |
| IUPAC Name | N'-methyl-3-(1-methylpyrazol-4-yl)-N-[[2-(2-morpholin-4-ylethoxy)phenyl]methyl]pyrrolidine-1-carboximidamide |
| SMILES | C/N=C(/NCc1ccccc1OCCN1CCOCC1)N1CCC(c2cnn(C)c2)C1 |
| InChI | InChI=1S/C23H34N6O2/c1-24-23(29-8-7-20(18-29)21-16-26-27(2)17-21)25-15-19-5-3-4-6-22(19)31-14-11-28-9-12-30-13-10-28/h3-6,16-17,20H,7-15,18H2,1-2H3,(H,24,25) |
| InChIKey | IZYVJZRPESQSDG-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.57 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|