C24H36N6 — CID 111996007
N-[[2-(azepan-1-ylmethyl)phenyl]methyl]-N'-methyl-3-(1-methylpyrazol-4-yl)pyrrolidine-1-carboximidamide (PubChem CID 111996007) has the molecular formula C24H36N6 and a molecular weight of 408.59 g/mol. Its IUPAC name is N-[[2-(azepan-1-ylmethyl)phenyl]methyl]-N'-methyl-3-(1-methylpyrazol-4-yl)pyrrolidine-1-carboximidamide.
| Compound Name | N-[[2-(azepan-1-ylmethyl)phenyl]methyl]-N'-methyl-3-(1-methylpyrazol-4-yl)pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111996007 |
| Molecular Formula | C24H36N6 |
| Molecular Weight | 408.59 g/mol |
| Exact Mass | 408.30 |
| IUPAC Name | N-[[2-(azepan-1-ylmethyl)phenyl]methyl]-N'-methyl-3-(1-methylpyrazol-4-yl)pyrrolidine-1-carboximidamide |
| SMILES | C/N=C(/NCc1ccccc1CN1CCCCCC1)N1CCC(c2cnn(C)c2)C1 |
| InChI | InChI=1S/C24H36N6/c1-25-24(30-14-11-22(19-30)23-16-27-28(2)17-23)26-15-20-9-5-6-10-21(20)18-29-12-7-3-4-8-13-29/h5-6,9-10,16-17,22H,3-4,7-8,11-15,18-19H2,1-2H3,(H,25,26) |
| InChIKey | ABNKZWYUGXPFTE-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 48.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.59 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|