C22H34N6 — CID 111741957
N'-methyl-N-[[2-[[methyl(propan-2-yl)amino]methyl]phenyl]methyl]-3-(1-methylpyrazol-4-yl)pyrrolidine-1-carboximidamide (PubChem CID 111741957) has the molecular formula C22H34N6 and a molecular weight of 382.56 g/mol. Its IUPAC name is N'-methyl-N-[[2-[[methyl(propan-2-yl)amino]methyl]phenyl]methyl]-3-(1-methylpyrazol-4-yl)pyrrolidine-1-carboximidamide.
| Compound Name | N'-methyl-N-[[2-[[methyl(propan-2-yl)amino]methyl]phenyl]methyl]-3-(1-methylpyrazol-4-yl)pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111741957 |
| Molecular Formula | C22H34N6 |
| Molecular Weight | 382.56 g/mol |
| Exact Mass | 382.28 |
| IUPAC Name | N'-methyl-N-[[2-[[methyl(propan-2-yl)amino]methyl]phenyl]methyl]-3-(1-methylpyrazol-4-yl)pyrrolidine-1-carboximidamide |
| SMILES | C/N=C(/NCc1ccccc1CN(C)C(C)C)N1CCC(c2cnn(C)c2)C1 |
| InChI | InChI=1S/C22H34N6/c1-17(2)26(4)14-19-9-7-6-8-18(19)12-24-22(23-3)28-11-10-20(16-28)21-13-25-27(5)15-21/h6-9,13,15,17,20H,10-12,14,16H2,1-5H3,(H,23,24) |
| InChIKey | CJEQKCFFCFDNML-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 48.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.56 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|