C20H35IN4 — CID 111210128
N',4-dimethyl-N-[[2-[[methyl(propan-2-yl)amino]methyl]phenyl]methyl]piperidine-1-carboximidamide;hydroiodide (PubChem CID 111210128) has the molecular formula C20H35IN4 and a molecular weight of 458.43 g/mol. Its IUPAC name is N',4-dimethyl-N-[[2-[[methyl(propan-2-yl)amino]methyl]phenyl]methyl]piperidine-1-carboximidamide;hydroiodide.
| Compound Name | N',4-dimethyl-N-[[2-[[methyl(propan-2-yl)amino]methyl]phenyl]methyl]piperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111210128 |
| Molecular Formula | C20H35IN4 |
| Molecular Weight | 458.43 g/mol |
| Exact Mass | 458.19 |
| IUPAC Name | N',4-dimethyl-N-[[2-[[methyl(propan-2-yl)amino]methyl]phenyl]methyl]piperidine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(/NCc1ccccc1CN(C)C(C)C)N1CCC(C)CC1.I |
| InChI | InChI=1S/C20H34N4.HI/c1-16(2)23(5)15-19-9-7-6-8-18(19)14-22-20(21-4)24-12-10-17(3)11-13-24;/h6-9,16-17H,10-15H2,1-5H3,(H,21,22);1H |
| InChIKey | SBUFNJACTZCWMH-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.43 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|