C23H40IN5O2 — CID 111729914
tert-butyl N-[1-[N'-methyl-N-[[2-[[methyl(propan-2-yl)amino]methyl]phenyl]methyl]carbamimidoyl]pyrrolidin-3-yl]carbamate;hydroiodide (PubChem CID 111729914) has the molecular formula C23H40IN5O2 and a molecular weight of 545.51 g/mol. Its IUPAC name is tert-butyl N-[1-[N'-methyl-N-[[2-[[methyl(propan-2-yl)amino]methyl]phenyl]methyl]carbamimidoyl]pyrrolidin-3-yl]carbamate;hydroiodide.
| Compound Name | tert-butyl N-[1-[N'-methyl-N-[[2-[[methyl(propan-2-yl)amino]methyl]phenyl]methyl]carbamimidoyl]pyrrolidin-3-yl]carbamate;hydroiodide |
|---|---|
| PubChem CID | 111729914 |
| Molecular Formula | C23H40IN5O2 |
| Molecular Weight | 545.51 g/mol |
| Exact Mass | 545.22 |
| IUPAC Name | tert-butyl N-[1-[N'-methyl-N-[[2-[[methyl(propan-2-yl)amino]methyl]phenyl]methyl]carbamimidoyl]pyrrolidin-3-yl]carbamate;hydroiodide |
| SMILES | C/N=C(/NCc1ccccc1CN(C)C(C)C)N1CCC(NC(=O)OC(C)(C)C)C1.I |
| InChI | InChI=1S/C23H39N5O2.HI/c1-17(2)27(7)15-19-11-9-8-10-18(19)14-25-21(24-6)28-13-12-20(16-28)26-22(29)30-23(3,4)5;/h8-11,17,20H,12-16H2,1-7H3,(H,24,25)(H,26,29);1H |
| InChIKey | DZDIMTSUSBZJSC-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.51 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|