C18H27BrN4O2 — CID 111978224
tert-butyl N-[1-[N-[(4-bromophenyl)methyl]-N'-methylcarbamimidoyl]pyrrolidin-3-yl]carbamate (PubChem CID 111978224) has the molecular formula C18H27BrN4O2 and a molecular weight of 411.34 g/mol. Its IUPAC name is tert-butyl N-[1-[N-[(4-bromophenyl)methyl]-N'-methylcarbamimidoyl]pyrrolidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[1-[N-[(4-bromophenyl)methyl]-N'-methylcarbamimidoyl]pyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 111978224 |
| Molecular Formula | C18H27BrN4O2 |
| Molecular Weight | 411.34 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | tert-butyl N-[1-[N-[(4-bromophenyl)methyl]-N'-methylcarbamimidoyl]pyrrolidin-3-yl]carbamate |
| SMILES | C/N=C(\NCc1ccc(Br)cc1)N1CCC(NC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C18H27BrN4O2/c1-18(2,3)25-17(24)22-15-9-10-23(12-15)16(20-4)21-11-13-5-7-14(19)8-6-13/h5-8,15H,9-12H2,1-4H3,(H,20,21)(H,22,24) |
| InChIKey | GCJLVBBAMRXBIF-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.34 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|