C22H35N5O4 — CID 111729319
tert-butyl N-[1-[N-[[3-[2-(dimethylamino)-2-oxoethoxy]phenyl]methyl]-N'-methylcarbamimidoyl]pyrrolidin-3-yl]carbamate (PubChem CID 111729319) has the molecular formula C22H35N5O4 and a molecular weight of 433.55 g/mol. Its IUPAC name is tert-butyl N-[1-[N-[[3-[2-(dimethylamino)-2-oxoethoxy]phenyl]methyl]-N'-methylcarbamimidoyl]pyrrolidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[1-[N-[[3-[2-(dimethylamino)-2-oxoethoxy]phenyl]methyl]-N'-methylcarbamimidoyl]pyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 111729319 |
| Molecular Formula | C22H35N5O4 |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.27 |
| IUPAC Name | tert-butyl N-[1-[N-[[3-[2-(dimethylamino)-2-oxoethoxy]phenyl]methyl]-N'-methylcarbamimidoyl]pyrrolidin-3-yl]carbamate |
| SMILES | C/N=C(/NCc1cccc(OCC(=O)N(C)C)c1)N1CCC(NC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C22H35N5O4/c1-22(2,3)31-21(29)25-17-10-11-27(14-17)20(23-4)24-13-16-8-7-9-18(12-16)30-15-19(28)26(5)6/h7-9,12,17H,10-11,13-15H2,1-6H3,(H,23,24)(H,25,29) |
| InChIKey | UMUCBXGGPDNPGS-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|