C18H26BrFN4O2 — CID 111730899
tert-butyl N-[1-[N-[(4-bromo-3-fluorophenyl)methyl]-N'-methylcarbamimidoyl]pyrrolidin-3-yl]carbamate (PubChem CID 111730899) has the molecular formula C18H26BrFN4O2 and a molecular weight of 429.33 g/mol. Its IUPAC name is tert-butyl N-[1-[N-[(4-bromo-3-fluorophenyl)methyl]-N'-methylcarbamimidoyl]pyrrolidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[1-[N-[(4-bromo-3-fluorophenyl)methyl]-N'-methylcarbamimidoyl]pyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 111730899 |
| Molecular Formula | C18H26BrFN4O2 |
| Molecular Weight | 429.33 g/mol |
| Exact Mass | 428.12 |
| IUPAC Name | tert-butyl N-[1-[N-[(4-bromo-3-fluorophenyl)methyl]-N'-methylcarbamimidoyl]pyrrolidin-3-yl]carbamate |
| SMILES | C/N=C(\NCc1ccc(Br)c(F)c1)N1CCC(NC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C18H26BrFN4O2/c1-18(2,3)26-17(25)23-13-7-8-24(11-13)16(21-4)22-10-12-5-6-14(19)15(20)9-12/h5-6,9,13H,7-8,10-11H2,1-4H3,(H,21,22)(H,23,25) |
| InChIKey | TYWKVTVHZGAGPR-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.33 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|