C19H28F2N4O2 — CID 111730149
tert-butyl N-[1-[N-[2-(2,6-difluorophenyl)ethyl]-N'-methylcarbamimidoyl]pyrrolidin-3-yl]carbamate (PubChem CID 111730149) has the molecular formula C19H28F2N4O2 and a molecular weight of 382.46 g/mol. Its IUPAC name is tert-butyl N-[1-[N-[2-(2,6-difluorophenyl)ethyl]-N'-methylcarbamimidoyl]pyrrolidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[1-[N-[2-(2,6-difluorophenyl)ethyl]-N'-methylcarbamimidoyl]pyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 111730149 |
| Molecular Formula | C19H28F2N4O2 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.22 |
| IUPAC Name | tert-butyl N-[1-[N-[2-(2,6-difluorophenyl)ethyl]-N'-methylcarbamimidoyl]pyrrolidin-3-yl]carbamate |
| SMILES | C/N=C(/NCCc1c(F)cccc1F)N1CCC(NC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C19H28F2N4O2/c1-19(2,3)27-18(26)24-13-9-11-25(12-13)17(22-4)23-10-8-14-15(20)6-5-7-16(14)21/h5-7,13H,8-12H2,1-4H3,(H,22,23)(H,24,26) |
| InChIKey | FHCKUOBVNMTSDE-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|