C23H38N4O3 — CID 111729803
tert-butyl N-[1-[N'-methyl-N-[[3-[(2-methylpropan-2-yl)oxymethyl]phenyl]methyl]carbamimidoyl]pyrrolidin-3-yl]carbamate (PubChem CID 111729803) has the molecular formula C23H38N4O3 and a molecular weight of 418.58 g/mol. Its IUPAC name is tert-butyl N-[1-[N'-methyl-N-[[3-[(2-methylpropan-2-yl)oxymethyl]phenyl]methyl]carbamimidoyl]pyrrolidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[1-[N'-methyl-N-[[3-[(2-methylpropan-2-yl)oxymethyl]phenyl]methyl]carbamimidoyl]pyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 111729803 |
| Molecular Formula | C23H38N4O3 |
| Molecular Weight | 418.58 g/mol |
| Exact Mass | 418.29 |
| IUPAC Name | tert-butyl N-[1-[N'-methyl-N-[[3-[(2-methylpropan-2-yl)oxymethyl]phenyl]methyl]carbamimidoyl]pyrrolidin-3-yl]carbamate |
| SMILES | C/N=C(/NCc1cccc(COC(C)(C)C)c1)N1CCC(NC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C23H38N4O3/c1-22(2,3)29-16-18-10-8-9-17(13-18)14-25-20(24-7)27-12-11-19(15-27)26-21(28)30-23(4,5)6/h8-10,13,19H,11-12,14-16H2,1-7H3,(H,24,25)(H,26,28) |
| InChIKey | JKDLJMZMNXABTK-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.58 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|