C23H34N6O3 — CID 111729535
tert-butyl N-[1-[N'-methyl-N-[[3-(3-propyl-1,2,4-oxadiazol-5-yl)phenyl]methyl]carbamimidoyl]pyrrolidin-3-yl]carbamate (PubChem CID 111729535) has the molecular formula C23H34N6O3 and a molecular weight of 442.56 g/mol. Its IUPAC name is tert-butyl N-[1-[N'-methyl-N-[[3-(3-propyl-1,2,4-oxadiazol-5-yl)phenyl]methyl]carbamimidoyl]pyrrolidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[1-[N'-methyl-N-[[3-(3-propyl-1,2,4-oxadiazol-5-yl)phenyl]methyl]carbamimidoyl]pyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 111729535 |
| Molecular Formula | C23H34N6O3 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.27 |
| IUPAC Name | tert-butyl N-[1-[N'-methyl-N-[[3-(3-propyl-1,2,4-oxadiazol-5-yl)phenyl]methyl]carbamimidoyl]pyrrolidin-3-yl]carbamate |
| SMILES | CCCc1noc(-c2cccc(CN/C(=N/C)N3CCC(NC(=O)OC(C)(C)C)C3)c2)n1 |
| InChI | InChI=1S/C23H34N6O3/c1-6-8-19-27-20(32-28-19)17-10-7-9-16(13-17)14-25-21(24-5)29-12-11-18(15-29)26-22(30)31-23(2,3)4/h7,9-10,13,18H,6,8,11-12,14-15H2,1-5H3,(H,24,25)(H,26,30) |
| InChIKey | PEAVSMWOFRRDKI-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 104.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|