C18H30IN5O4S — CID 111730084
tert-butyl N-[1-[N'-methyl-N-[(3-sulfamoylphenyl)methyl]carbamimidoyl]pyrrolidin-3-yl]carbamate;hydroiodide (PubChem CID 111730084) has the molecular formula C18H30IN5O4S and a molecular weight of 539.44 g/mol. Its IUPAC name is tert-butyl N-[1-[N'-methyl-N-[(3-sulfamoylphenyl)methyl]carbamimidoyl]pyrrolidin-3-yl]carbamate;hydroiodide.
| Compound Name | tert-butyl N-[1-[N'-methyl-N-[(3-sulfamoylphenyl)methyl]carbamimidoyl]pyrrolidin-3-yl]carbamate;hydroiodide |
|---|---|
| PubChem CID | 111730084 |
| Molecular Formula | C18H30IN5O4S |
| Molecular Weight | 539.44 g/mol |
| Exact Mass | 539.11 |
| IUPAC Name | tert-butyl N-[1-[N'-methyl-N-[(3-sulfamoylphenyl)methyl]carbamimidoyl]pyrrolidin-3-yl]carbamate;hydroiodide |
| SMILES | C/N=C(/NCc1cccc(S(N)(=O)=O)c1)N1CCC(NC(=O)OC(C)(C)C)C1.I |
| InChI | InChI=1S/C18H29N5O4S.HI/c1-18(2,3)27-17(24)22-14-8-9-23(12-14)16(20-4)21-11-13-6-5-7-15(10-13)28(19,25)26;/h5-7,10,14H,8-9,11-12H2,1-4H3,(H,20,21)(H,22,24)(H2,19,25,26);1H |
| InChIKey | BUNWBINJIQBVLY-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 126.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.44 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|