C21H34N4O3 — CID 111731019
tert-butyl N-[1-[N-ethyl-N'-[[3-(methoxymethyl)phenyl]methyl]carbamimidoyl]pyrrolidin-3-yl]carbamate (PubChem CID 111731019) has the molecular formula C21H34N4O3 and a molecular weight of 390.53 g/mol. Its IUPAC name is tert-butyl N-[1-[N-ethyl-N'-[[3-(methoxymethyl)phenyl]methyl]carbamimidoyl]pyrrolidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[1-[N-ethyl-N'-[[3-(methoxymethyl)phenyl]methyl]carbamimidoyl]pyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 111731019 |
| Molecular Formula | C21H34N4O3 |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.26 |
| IUPAC Name | tert-butyl N-[1-[N-ethyl-N'-[[3-(methoxymethyl)phenyl]methyl]carbamimidoyl]pyrrolidin-3-yl]carbamate |
| SMILES | CCN/C(=N\Cc1cccc(COC)c1)N1CCC(NC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C21H34N4O3/c1-6-22-19(23-13-16-8-7-9-17(12-16)15-27-5)25-11-10-18(14-25)24-20(26)28-21(2,3)4/h7-9,12,18H,6,10-11,13-15H2,1-5H3,(H,22,23)(H,24,26) |
| InChIKey | CFIJICPEVFUWOA-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|