C24H39N5O3 — CID 111729075
tert-butyl N-[1-[N'-[[3-(butan-2-ylcarbamoyl)phenyl]methyl]-N-ethylcarbamimidoyl]pyrrolidin-3-yl]carbamate (PubChem CID 111729075) has the molecular formula C24H39N5O3 and a molecular weight of 445.61 g/mol. Its IUPAC name is tert-butyl N-[1-[N'-[[3-(butan-2-ylcarbamoyl)phenyl]methyl]-N-ethylcarbamimidoyl]pyrrolidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[1-[N'-[[3-(butan-2-ylcarbamoyl)phenyl]methyl]-N-ethylcarbamimidoyl]pyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 111729075 |
| Molecular Formula | C24H39N5O3 |
| Molecular Weight | 445.61 g/mol |
| Exact Mass | 445.31 |
| IUPAC Name | tert-butyl N-[1-[N'-[[3-(butan-2-ylcarbamoyl)phenyl]methyl]-N-ethylcarbamimidoyl]pyrrolidin-3-yl]carbamate |
| SMILES | CCN/C(=N\Cc1cccc(C(=O)NC(C)CC)c1)N1CCC(NC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C24H39N5O3/c1-7-17(3)27-21(30)19-11-9-10-18(14-19)15-26-22(25-8-2)29-13-12-20(16-29)28-23(31)32-24(4,5)6/h9-11,14,17,20H,7-8,12-13,15-16H2,1-6H3,(H,25,26)(H,27,30)(H,28,31) |
| InChIKey | IKZNHMNMEPRVBZ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.61 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|