C23H36FN5O3 — CID 111730201
tert-butyl N-[1-[N-ethyl-N'-[(3-fluoro-4-morpholin-4-ylphenyl)methyl]carbamimidoyl]pyrrolidin-3-yl]carbamate (PubChem CID 111730201) has the molecular formula C23H36FN5O3 and a molecular weight of 449.57 g/mol. Its IUPAC name is tert-butyl N-[1-[N-ethyl-N'-[(3-fluoro-4-morpholin-4-ylphenyl)methyl]carbamimidoyl]pyrrolidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[1-[N-ethyl-N'-[(3-fluoro-4-morpholin-4-ylphenyl)methyl]carbamimidoyl]pyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 111730201 |
| Molecular Formula | C23H36FN5O3 |
| Molecular Weight | 449.57 g/mol |
| Exact Mass | 449.28 |
| IUPAC Name | tert-butyl N-[1-[N-ethyl-N'-[(3-fluoro-4-morpholin-4-ylphenyl)methyl]carbamimidoyl]pyrrolidin-3-yl]carbamate |
| SMILES | CCN/C(=N\Cc1ccc(N2CCOCC2)c(F)c1)N1CCC(NC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C23H36FN5O3/c1-5-25-21(29-9-8-18(16-29)27-22(30)32-23(2,3)4)26-15-17-6-7-20(19(24)14-17)28-10-12-31-13-11-28/h6-7,14,18H,5,8-13,15-16H2,1-4H3,(H,25,26)(H,27,30) |
| InChIKey | DXUKPMIXWZGOMW-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.57 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|