C21H41N5O3 — CID 111730191
tert-butyl N-[1-[N-ethyl-N'-(3-methyl-2-morpholin-4-ylbutyl)carbamimidoyl]pyrrolidin-3-yl]carbamate (PubChem CID 111730191) has the molecular formula C21H41N5O3 and a molecular weight of 411.59 g/mol. Its IUPAC name is tert-butyl N-[1-[N-ethyl-N'-(3-methyl-2-morpholin-4-ylbutyl)carbamimidoyl]pyrrolidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[1-[N-ethyl-N'-(3-methyl-2-morpholin-4-ylbutyl)carbamimidoyl]pyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 111730191 |
| Molecular Formula | C21H41N5O3 |
| Molecular Weight | 411.59 g/mol |
| Exact Mass | 411.32 |
| IUPAC Name | tert-butyl N-[1-[N-ethyl-N'-(3-methyl-2-morpholin-4-ylbutyl)carbamimidoyl]pyrrolidin-3-yl]carbamate |
| SMILES | CCN/C(=N\CC(C(C)C)N1CCOCC1)N1CCC(NC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C21H41N5O3/c1-7-22-19(23-14-18(16(2)3)25-10-12-28-13-11-25)26-9-8-17(15-26)24-20(27)29-21(4,5)6/h16-18H,7-15H2,1-6H3,(H,22,23)(H,24,27) |
| InChIKey | XQXSNQGOKRNGFX-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.59 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|