C19H39N5O2 — CID 111730217
tert-butyl N-[1-[N'-[2-[butan-2-yl(methyl)amino]ethyl]-N-ethylcarbamimidoyl]pyrrolidin-3-yl]carbamate (PubChem CID 111730217) has the molecular formula C19H39N5O2 and a molecular weight of 369.55 g/mol. Its IUPAC name is tert-butyl N-[1-[N'-[2-[butan-2-yl(methyl)amino]ethyl]-N-ethylcarbamimidoyl]pyrrolidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[1-[N'-[2-[butan-2-yl(methyl)amino]ethyl]-N-ethylcarbamimidoyl]pyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 111730217 |
| Molecular Formula | C19H39N5O2 |
| Molecular Weight | 369.55 g/mol |
| Exact Mass | 369.31 |
| IUPAC Name | tert-butyl N-[1-[N'-[2-[butan-2-yl(methyl)amino]ethyl]-N-ethylcarbamimidoyl]pyrrolidin-3-yl]carbamate |
| SMILES | CCN/C(=N\CCN(C)C(C)CC)N1CCC(NC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C19H39N5O2/c1-8-15(3)23(7)13-11-21-17(20-9-2)24-12-10-16(14-24)22-18(25)26-19(4,5)6/h15-16H,8-14H2,1-7H3,(H,20,21)(H,22,25) |
| InChIKey | CXPDQUYTXMSIBY-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.55 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|