C18H37N5O3 — CID 111729713
tert-butyl N-[1-[N-ethyl-N'-[2-[2-methoxyethyl(methyl)amino]ethyl]carbamimidoyl]pyrrolidin-3-yl]carbamate (PubChem CID 111729713) has the molecular formula C18H37N5O3 and a molecular weight of 371.53 g/mol. Its IUPAC name is tert-butyl N-[1-[N-ethyl-N'-[2-[2-methoxyethyl(methyl)amino]ethyl]carbamimidoyl]pyrrolidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[1-[N-ethyl-N'-[2-[2-methoxyethyl(methyl)amino]ethyl]carbamimidoyl]pyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 111729713 |
| Molecular Formula | C18H37N5O3 |
| Molecular Weight | 371.53 g/mol |
| Exact Mass | 371.29 |
| IUPAC Name | tert-butyl N-[1-[N-ethyl-N'-[2-[2-methoxyethyl(methyl)amino]ethyl]carbamimidoyl]pyrrolidin-3-yl]carbamate |
| SMILES | CCN/C(=N\CCN(C)CCOC)N1CCC(NC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C18H37N5O3/c1-7-19-16(20-9-11-22(5)12-13-25-6)23-10-8-15(14-23)21-17(24)26-18(2,3)4/h15H,7-14H2,1-6H3,(H,19,20)(H,21,24) |
| InChIKey | QBYGHGYGYIWNLW-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.53 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|