C22H43N5O2 — CID 111729409
tert-butyl N-[1-[N-ethyl-N'-[4-(4-methylpiperidin-1-yl)butyl]carbamimidoyl]pyrrolidin-3-yl]carbamate (PubChem CID 111729409) has the molecular formula C22H43N5O2 and a molecular weight of 409.62 g/mol. Its IUPAC name is tert-butyl N-[1-[N-ethyl-N'-[4-(4-methylpiperidin-1-yl)butyl]carbamimidoyl]pyrrolidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[1-[N-ethyl-N'-[4-(4-methylpiperidin-1-yl)butyl]carbamimidoyl]pyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 111729409 |
| Molecular Formula | C22H43N5O2 |
| Molecular Weight | 409.62 g/mol |
| Exact Mass | 409.34 |
| IUPAC Name | tert-butyl N-[1-[N-ethyl-N'-[4-(4-methylpiperidin-1-yl)butyl]carbamimidoyl]pyrrolidin-3-yl]carbamate |
| SMILES | CCN/C(=N\CCCCN1CCC(C)CC1)N1CCC(NC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C22H43N5O2/c1-6-23-20(24-12-7-8-13-26-14-9-18(2)10-15-26)27-16-11-19(17-27)25-21(28)29-22(3,4)5/h18-19H,6-17H2,1-5H3,(H,23,24)(H,25,28) |
| InChIKey | ZICDTBWGZGWRBJ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.62 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|