C17H34N4O2 — CID 111212217
tert-butyl N-[3-[[ethylamino-(4-methylpiperidin-1-yl)methylidene]amino]propyl]carbamate (PubChem CID 111212217) has the molecular formula C17H34N4O2 and a molecular weight of 326.49 g/mol. Its IUPAC name is tert-butyl N-[3-[[ethylamino-(4-methylpiperidin-1-yl)methylidene]amino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[[ethylamino-(4-methylpiperidin-1-yl)methylidene]amino]propyl]carbamate |
|---|---|
| PubChem CID | 111212217 |
| Molecular Formula | C17H34N4O2 |
| Molecular Weight | 326.49 g/mol |
| Exact Mass | 326.27 |
| IUPAC Name | tert-butyl N-[3-[[ethylamino-(4-methylpiperidin-1-yl)methylidene]amino]propyl]carbamate |
| SMILES | CCN/C(=N\CCCNC(=O)OC(C)(C)C)N1CCC(C)CC1 |
| InChI | InChI=1S/C17H34N4O2/c1-6-18-15(21-12-8-14(2)9-13-21)19-10-7-11-20-16(22)23-17(3,4)5/h14H,6-13H2,1-5H3,(H,18,19)(H,20,22) |
| InChIKey | SCEGGOICPOUMLL-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.49 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|